CAS
176225-10-8 Purity
---
176225-10-8 Purity
---
Inquiry Basket
3-Bromo-4-trifluoromethoxyaniline
CAS
191602-54-7
Catalog Number
ACM191602547
Category
Bromine Series
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the IUPAC name of the compound with PubChem CID 2736418?
The IUPAC name is 3-bromo-4-(trifluoromethoxy)aniline.
What is the molecular formula of the compound?
The molecular formula is C7H5BrF3NO.
What is the molecular weight of the compound?
The molecular weight is 256.02 g/mol.
What are some synonyms for the compound?
Some synonyms include 3-bromo-4-trifluoromethoxyaniline and 3-bromo-4-(trifluoromethoxy)aniline.
What is the Canonical SMILES representation of the compound?
C1=CC(=C(C=C1N)Br)OC(F)(F)F
How many hydrogen bond donor counts does the compound have?
The compound has 1 hydrogen bond donor count.
What is the exact mass of the compound?
The exact mass is 254.95066 g/mol.
How many hydrogen bond acceptor counts does the compound have?
The compound has 5 hydrogen bond acceptor counts.
Is the compound canonicalized?
Yes, the compound is canonicalized.
What is the topological polar surface area of the compound?
The topological polar surface area is 35.2Ų.
Recommended Products
