3-Bromo-1H-indazole-5-carbonitrile

• CAS: 395101-67-4
• Catalog Number: ACM395101674
• Category: Bromine Series
• Molecular Formula: C₈H₄N₃Br
• Synonyms: 3-BROMO-5-CYANO (1H)INDAZOLE

Custom Q&A

What is the molecular formula of 3-Bromo-1H-indazole-5-carbonitrile?

The molecular formula is C8H4BrN3.

What is the molecular weight of 3-Bromo-1H-indazole-5-carbonitrile?

The molecular weight is 222.04 g/mol.

What is the IUPAC name of 3-Bromo-1H-indazole-5-carbonitrile?

The IUPAC name is 3-bromo-2H-indazole-5-carbonitrile.

What is the InChI of 3-Bromo-1H-indazole-5-carbonitrile?

The InChI is InChI=1S/C8H4BrN3/c9-8-6-3-5(4-10)1-2-7(6)11-12-8/h1-3H,(H,11,12).

What is the InChIKey of 3-Bromo-1H-indazole-5-carbonitrile?

The InChIKey is WVHZCDQLDZQYPH-UHFFFAOYSA-N.

What is the canonical SMILES of 3-Bromo-1H-indazole-5-carbonitrile?

The canonical SMILES is C1=CC2=NNC(=C2C=C1C#N)Br.

What is the CAS number of 3-Bromo-1H-indazole-5-carbonitrile?

The CAS number is 395101-67-4.

What is the XLogP3-AA value of 3-Bromo-1H-indazole-5-carbonitrile?

The XLogP3-AA value is 2.3.

How many hydrogen bond donor count does 3-Bromo-1H-indazole-5-carbonitrile have?

It has 1 hydrogen bond donor count.

How many hydrogen bond acceptor count does 3-Bromo-1H-indazole-5-carbonitrile have?

It has 2 hydrogen bond acceptor count.