CAS
28611-39-4 Purity
96%
28611-39-4 Purity
96%
Inquiry Basket
3-Amino-4-fluorophenylboronic acid
CAS
873566-75-7
Catalog Number
ACM873566757
Category
Boro-Amino Acids
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of the compound?
The molecular formula of the compound is C6H7BFNO2.
What is the molecular weight of the compound?
The molecular weight of the compound is 154.94 g/mol.
What is the IUPAC name of the compound?
The IUPAC name of the compound is (3-amino-4-fluorophenyl)boronic acid.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C6H7BFNO2/c8-5-2-1-4(7(10)11)3-6(5)9/h1-3,10-11H,9H2.
What is the InChIKey of the compound?
The InChIKey of the compound is SYBMNJPUZMUPGQ-UHFFFAOYSA-N.
What is the canonical SMILES representation of the compound?
The canonical SMILES representation of the compound is B(C1=CC(=C(C=C1)F)N)(O)O.
What is the CAS number of the compound?
The CAS number of the compound is 873566-75-7.
What is the EC number of the compound?
The EC number of the compound is 689-890-5.
What is the hydrogen bond donor count of the compound?
The hydrogen bond donor count of the compound is 3.
What is the hydrogen bond acceptor count of the compound?
The hydrogen bond acceptor count of the compound is 4.
Recommended Products
