3-Amino-2-methylphenylboronic acid, pinacol ester

• CAS: 882678-96-8
• Catalog Number: ACM882678968-1
• Category: Boronic Esters

Custom Q&A

What is the molecular formula of 3-Amino-2-methylphenylboronic acid pinacol ester?

The molecular formula is C13H20BNO2.

What is the molecular weight of 3-Amino-2-methylphenylboronic acid pinacol ester?

The molecular weight is 233.12 g/mol.

What is the IUPAC name of 3-Amino-2-methylphenylboronic acid pinacol ester?

The IUPAC name is 2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline.

What is the Canonical SMILES of 3-Amino-2-methylphenylboronic acid pinacol ester?

The Canonical SMILES is B1(OC(C(O1)(C)C)(C)C)C2=C(C(=CC=C2)N)C.

How many hydrogen bond donor counts are present in 3-Amino-2-methylphenylboronic acid pinacol ester?

There is 1 hydrogen bond donor count.

How many hydrogen bond acceptor counts are present in 3-Amino-2-methylphenylboronic acid pinacol ester?

There are 3 hydrogen bond acceptor counts.

What is the exact mass of 3-Amino-2-methylphenylboronic acid pinacol ester?

The exact mass is 233.1587090 g/mol.

What is the topological polar surface area of 3-Amino-2-methylphenylboronic acid pinacol ester?

The topological polar surface area is 44.5 Ų.

How many heavy atoms are present in 3-Amino-2-methylphenylboronic acid pinacol ester?

There are 17 heavy atoms.

Is 3-Amino-2-methylphenylboronic acid pinacol ester a canonicalized compound?

Yes, it is a canonicalized compound.