CAS
126325-47-1 Purity
---
126325-47-1 Purity
---
Inquiry Basket
3-Amino-2-methyl-5-bromo benzoic acid methyl ester
CAS
1000342-11-9
Catalog Number
ACM1000342119
Category
Bromine Series
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of the compound?
The molecular formula of the compound is C9H10BrNO2.
What is the molecular weight of the compound?
The molecular weight of the compound is 244.08 g/mol.
What is the IUPAC name of the compound?
The IUPAC name of the compound is methyl 3-amino-5-bromo-2-methylbenzoate.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C9H10BrNO2/c1-5-7(9(12)13-2)3-6(10)4-8(5)11/h3-4H,11H2,1-2H3.
What is the InChIKey of the compound?
The InChIKey of the compound is NMLOSXSDLWFBKT-UHFFFAOYSA-N.
What is the CAS number of the compound?
The CAS number of the compound is 1000342-11-9.
What is the XLogP3-AA value of the compound?
The XLogP3-AA value of the compound is 2.1.
How many hydrogen bond donor counts does the compound have?
The compound has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does the compound have?
The compound has 3 hydrogen bond acceptor counts.
What is the topological polar surface area of the compound?
The topological polar surface area of the compound is 52.3Ų.
Recommended Products
