91678-81-8 Purity
97%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of 3,6-dibromopyrazine-2-carboxylic acid is C5H2Br2N2O2.
The molecular weight of 3,6-dibromopyrazine-2-carboxylic acid is 281.89 g/mol.
The IUPAC name of 3,6-dibromopyrazine-2-carboxylic acid is 3,6-dibromopyrazine-2-carboxylic acid.
The InChIKey of 3,6-dibromopyrazine-2-carboxylic acid is MJOLIBQBOIULPY-UHFFFAOYSA-N.
The canonical SMILES of 3,6-dibromopyrazine-2-carboxylic acid is C1=C(N=C(C(=N1)Br)C(=O)O)Br.
The CAS number of 3,6-dibromopyrazine-2-carboxylic acid is 957230-68-1.
The XLogP3-AA value of 3,6-dibromopyrazine-2-carboxylic acid is 1.7.
3,6-dibromopyrazine-2-carboxylic acid has 1 hydrogen bond donor count.
3,6-dibromopyrazine-2-carboxylic acid has 4 hydrogen bond acceptor count.
3,6-dibromopyrazine-2-carboxylic acid has 1 rotatable bond count.