3,5-Dibromo-2-fluoro-4-picoline

• CAS: 1000340-01-1
• Catalog Number: ACM1000340011
• Category: Bromine Series
• Molecular Weight: 268.9090632
• Molecular Formula: C₆H₄NBr₂F
• Synonyms: 3,5-Dibromo-2-fluoro-4-methylpyridine;3,5-Dibromo-2-fluoro-4-picoline;2-Fluoro-3,5-dibromo-4-methylpyridine

Custom Q&A

What is the molecular formula of the compound?

The molecular formula of the compound is C6H4Br2FN.

What is the molecular weight of the compound?

The molecular weight of the compound is 268.91 g/mol.

What is the IUPAC name of the compound?

The IUPAC name of the compound is 3,5-dibromo-2-fluoro-4-methylpyridine.

What is the InChI of the compound?

The InChI of the compound is InChI=1S/C6H4Br2FN/c1-3-4(7)2-10-6(9)5(3)8/h2H,1H3.

What is the InChIKey of the compound?

The InChIKey of the compound is LAOILGACTMFPSZ-UHFFFAOYSA-N.

What is the canonical SMILES of the compound?

The canonical SMILES of the compound is CC1=C(C(=NC=C1Br)F)Br.

What is the CAS number of the compound?

The CAS number of the compound is 1000340-01-1.

What is the XLogP3-AA value of the compound?

The XLogP3-AA value of the compound is 3.

How many hydrogen bond donor counts does the compound have?

The compound has 0 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does the compound have?

The compound has 2 hydrogen bond acceptor counts.