3,4-Methylenedioxyphenylboronic acid, pinacol ester

• CAS: 94838-82-1
• Catalog Number: ACM94838821-1
• Category: Boronic Esters

Custom Q&A

What is the molecular formula of 3,4-Methylenedioxyphenylboronic acid, pinacol ester?

The molecular formula is C13H17BO4.

What is the molecular weight of 3,4-Methylenedioxyphenylboronic acid, pinacol ester?

The molecular weight is 248.08 g/mol.

What is the IUPAC name of 3,4-Methylenedioxyphenylboronic acid, pinacol ester?

The IUPAC name is 2-(1,3-benzodioxol-5-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.

What is the InChI of 3,4-Methylenedioxyphenylboronic acid, pinacol ester?

The InChI is InChI=1S/C13H17BO4/c1-12(2)13(3,4)18-14(17-12)9-5-6-10-11(7-9)16-8-15-10/h5-7H,8H2,1-4H3.

What is the InChIKey of 3,4-Methylenedioxyphenylboronic acid, pinacol ester?

The InChIKey is OZPPRBAFKGOJLZ-UHFFFAOYSA-N.

What is the canonical SMILES of 3,4-Methylenedioxyphenylboronic acid, pinacol ester?

The canonical SMILES is B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=C2)OCO3.

What is the CAS number of 3,4-Methylenedioxyphenylboronic acid, pinacol ester?

The CAS number is 94838-82-1.

What is the EC number of 3,4-Methylenedioxyphenylboronic acid, pinacol ester?

The EC number is 674-999-2.

Is 3,4-Methylenedioxyphenylboronic acid, pinacol ester a canonicalized compound?

Yes, it is a canonicalized compound.