3-(3,5-Dibromophenyl)propionic acid

• CAS: 923977-15-5
• Catalog Number: ACM923977155
• Category: Alkenes
• Molecular Weight: 307.97
• Molecular Formula: C₁₄H₁₉NO₂S
• Hazard Statements: H225
• RIDADR: UN 3295C 3 / PGIII
• Symbol: GHS02

Custom Q&A

What is the IUPAC name of the compound?

The IUPAC name of the compound is 3-(3,5-dibromophenyl)propanoic acid.

What is the molecular formula of the compound?

The molecular formula of the compound is C9H8Br2O2.

What is the molecular weight of the compound?

The molecular weight of the compound is 307.97 g/mol.

What is the InChI of the compound?

The InChI of the compound is InChI=1S/C9H8Br2O2/c10-7-3-6(1-2-9(12)13)4-8(11)5-7/h3-5H,1-2H2,(H,12,13).

What is the InChIKey of the compound?

The InChIKey of the compound is AMKWPMUHANVQSZ-UHFFFAOYSA-N.

What is the canonical SMILES of the compound?

The canonical SMILES of the compound is C1=C(C=C(C=C1Br)Br)CCC(=O)O.

What is the CAS number of the compound?

The CAS number of the compound is 923977-15-5.

What is the EC number of the compound?

The EC number of the compound is 663-729-9.

What is the XLogP3-AA value of the compound?

The XLogP3-AA value of the compound is 3.1.

Is the compound canonicalized?

Yes, the compound is canonicalized.