156545-07-2 Purity
98%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of 2-Methylphenylboronic acid is C7H9BO2.
The molecular weight of 2-Methylphenylboronic acid is 135.96 g/mol.
The IUPAC name of 2-Methylphenylboronic acid is (2-methylphenyl)boronic acid.
The InChI of 2-Methylphenylboronic acid is InChI=1S/C7H9BO2/c1-6-4-2-3-5-7(6)8(9)10/h2-5,9-10H,1H3.
2-Methylphenylboronic acid has 2 hydrogen bond donor counts.
The topological polar surface area of 2-Methylphenylboronic acid is 40.5 Ų.
No, 2-Methylphenylboronic acid does not have any defined atom stereocenter count.
The formal charge of 2-Methylphenylboronic acid is 0.
The canonical SMILES of 2-Methylphenylboronic acid is B(C1=CC=CC=C1C)(O)O.
The covalently-bonded unit count of 2-Methylphenylboronic acid is 1.