CAS
60480-83-3 Purity
---
60480-83-3 Purity
---
Inquiry Basket
2-Methylcitric Acid
CAS
6061-96-7
Catalog Number
ACM6061967
Category
Other Products
Molecular Weight
206.15
Molecular Formula
C7H10O7
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
Specification
Synonyms
2-METHYLCITRIC ACID;DL-2-METHYLCITRIC ACID;2-Methylcitric Acid (unlabelled);2-hydroxybutane-1,2,3-tricarboxylic acid;2-Hydroxy-3-methyl-1,2,3-propanetricarboxylic acid;Methylcitric acid
What is the molecular formula of 2-Methylcitric acid?
The molecular formula of 2-Methylcitric acid is C7H10O7.
What is the molecular weight of 2-Methylcitric acid?
The molecular weight of 2-Methylcitric acid is 206.15 g/mol.
What is the IUPAC name of 2-Methylcitric acid?
The IUPAC name of 2-Methylcitric acid is 2-hydroxybutane-1,2,3-tricarboxylic acid.
What is the InChI of 2-Methylcitric acid?
The InChI of 2-Methylcitric acid is InChI=1S/C7H10O7/c1-3(5(10)11)7(14,6(12)13)2-4(8)9/h3,14H,2H2,1H3,(H,8,9)(H,10,11)(H,12,13).
What is the InChIKey of 2-Methylcitric acid?
The InChIKey of 2-Methylcitric acid is YNOXCRMFGMSKIJ-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Methylcitric acid?
The canonical SMILES of 2-Methylcitric acid is CC(C(=O)O)C(CC(=O)O)(C(=O)O)O.
What is the CAS number of 2-Methylcitric acid?
The CAS number of 2-Methylcitric acid is 6061-96-7.
What is the hydrogen bond donor count of 2-Methylcitric acid?
The hydrogen bond donor count of 2-Methylcitric acid is 4.
What is the hydrogen bond acceptor count of 2-Methylcitric acid?
The hydrogen bond acceptor count of 2-Methylcitric acid is 7.
What is the topological polar surface area of 2-Methylcitric acid?
The topological polar surface area of 2-Methylcitric acid is 132Å2.
Recommended Products
![2,2-Bis[[(2-hexyl-1-oxodecyl)oxy]methyl]-1,3-propanediyl bis(2-hexyldecanoate)](https://resource.alfa-chemistry.com/structure/60623-04-3.gif)
CAS
60623-04-3 Purity
---
60623-04-3 Purity
---
