2-Methyl-2-phenoxypropanoic acid

• CAS: 943-45-3
• Catalog Number: ACM943453
• Category: Other Products
• Molecular Weight: 180.20
• Molecular Formula: C₁₀H₁₂O₃

Custom Q&A

What is the molecular formula of 2-Methyl-2-phenoxypropanoic acid?

The molecular formula of 2-Methyl-2-phenoxypropanoic acid is C10H12O3.

What is the molecular weight of 2-Methyl-2-phenoxypropanoic acid?

The molecular weight of 2-Methyl-2-phenoxypropanoic acid is 180.20 g/mol.

What is the IUPAC name of 2-Methyl-2-phenoxypropanoic acid?

The IUPAC name of 2-Methyl-2-phenoxypropanoic acid is 2-methyl-2-phenoxypropanoic acid.

What is the InChI of 2-Methyl-2-phenoxypropanoic acid?

The InChI of 2-Methyl-2-phenoxypropanoic acid is InChI=1S/C10H12O3/c1-10(2,9(11)12)13-8-6-4-3-5-7-8/h3-7H,1-2H3,(H,11,12).

What is the InChIKey of 2-Methyl-2-phenoxypropanoic acid?

The InChIKey of 2-Methyl-2-phenoxypropanoic acid is ILPUOPPYSQEBNJ-UHFFFAOYSA-N.

What is the canonical SMILES of 2-Methyl-2-phenoxypropanoic acid?

The canonical SMILES of 2-Methyl-2-phenoxypropanoic acid is CC(C)(C(=O)O)OC1=CC=CC=C1.

What is the CAS number of 2-Methyl-2-phenoxypropanoic acid?

The CAS number of 2-Methyl-2-phenoxypropanoic acid is 943-45-3.

What is the European Community (EC) number of 2-Methyl-2-phenoxypropanoic acid?

The European Community (EC) number of 2-Methyl-2-phenoxypropanoic acid is 213-402-8.

What is the UNII of 2-Methyl-2-phenoxypropanoic acid?

The UNII of 2-Methyl-2-phenoxypropanoic acid is 6848ST447Q.

What is the molecular weight, XLogP3, hydrogen bond donor count, hydrogen bond acceptor count, rotatable bond count, exact mass, monoisotopic mass, topological polar surface area, heavy atom count, formal charge, complexity, isotope atom count, defined atom stereocenter count, undefined atom stereocenter count, defined bond stereocenter count, undefined bond stereocenter count, covalently-bonded unit count, and compound is canonicalized property value of 2-Methyl-2-phenoxypropanoic acid?

The molecular weight is 180.20 g/mol, XLogP3 is 1.9, hydrogen bond donor count is 1, hydrogen bond acceptor count is 3, rotatable bond count is 3, exact mass is 180.078644241 g/mol, monoisotopic mass is 180.078644241 g/mol, topological polar surface area is 46.5 ?^2, heavy atom count is 13, formal charge is 0, complexity is 181, isotope atom count is 0, defined atom stereocenter count is 0, undefined atom stereocenter count is 0, defined bond stereocenter count is 0, undefined bond stereocenter count is 0, covalently-bonded unit count is 1, and compound is canonicalized property value is Yes.