2-Methoxymethylphenylboronic acid

• CAS: 126617-98-9
• Catalog Number: ACM126617989
• Category: Boronic Acids
• Molecular Weight: 165.98
• Molecular Formula: C₈H₁₁BO₃

Custom Q&A

What is the molecular formula of 2-Methoxymethylphenylboronic acid?

The molecular formula of 2-Methoxymethylphenylboronic acid is C8H11BO3.

What is the molecular weight of 2-Methoxymethylphenylboronic acid?

The molecular weight of 2-Methoxymethylphenylboronic acid is 165.98 g/mol.

What is the IUPAC name of 2-Methoxymethylphenylboronic acid?

The IUPAC name of 2-Methoxymethylphenylboronic acid is [2-(methoxymethyl)phenyl]boronic acid.

What is the InChI of 2-Methoxymethylphenylboronic acid?

The InChI of 2-Methoxymethylphenylboronic acid is InChI=1S/C8H11BO3/c1-12-6-7-4-2-3-5-8(7)9(10)11/h2-5,10-11H,6H2,1H3.

What is the InChIKey of 2-Methoxymethylphenylboronic acid?

The InChIKey of 2-Methoxymethylphenylboronic acid is JHPPAFXQJZJGEP-UHFFFAOYSA-N.

What is the canonical SMILES of 2-Methoxymethylphenylboronic acid?

The canonical SMILES of 2-Methoxymethylphenylboronic acid is B(C1=CC=CC=C1COC)(O)O.

What is the CAS number of 2-Methoxymethylphenylboronic acid?

The CAS number of 2-Methoxymethylphenylboronic acid is 126617-98-9.

What is the European Community (EC) number of 2-Methoxymethylphenylboronic acid?

The European Community (EC) number of 2-Methoxymethylphenylboronic acid is 805-602-4.

What is the DSSTox Substance ID of 2-Methoxymethylphenylboronic acid?

The DSSTox Substance ID of 2-Methoxymethylphenylboronic acid is DTXSID00396031.

Is 2-Methoxymethylphenylboronic acid a canonicalized compound?

Yes, 2-Methoxymethylphenylboronic acid is a canonicalized compound.