2-Chloro-6-fluoro-3-hydroxyphenylboronic acid

• CAS: 957121-07-2
• Catalog Number: ACM957121072
• Category: Other Products; Boronic Acids
• Molecular Formula: C₆H₅BClFO₃

Custom Q&A

What is the molecular formula of the compound?

The molecular formula of the compound is C6H5BClFO3.

What is the molecular weight of the compound?

The molecular weight of the compound is 190.37 g/mol.

When was the compound created?

The compound was created on January 26, 2010.

When was the compound last modified?

The compound was last modified on December 2, 2023.

What is the IUPAC name of the compound?

The IUPAC name of the compound is (2-chloro-6-fluoro-3-hydroxyphenyl)boronic acid.

What is the InChI of the compound?

The InChI of the compound is InChI=1S/C6H5BClFO3/c8-6-4(10)2-1-3(9)5(6)7(11)12/h1-2,10-12H.

What is the InChIKey of the compound?

The InChIKey of the compound is MMQMWHTYNPPUMF-UHFFFAOYSA-N.

What is the canonical SMILES of the compound?

The canonical SMILES of the compound is B(C1=C(C=CC(=C1Cl)O)F)(O)O.

What is the CAS number of the compound?

The CAS number of the compound is 957121-07-2.

What is the formal charge of the compound?

The formal charge of the compound is 0.