CAS
1011-13-8 Purity
95%
1011-13-8 Purity
95%
Inquiry Basket
2-Bromo-5-(trifluoromethyl)benzyl alcohol
CAS
869725-53-1
Catalog Number
ACM869725531
Category
Bromine Series
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of the compound?
The molecular formula of the compound is C8H6BrF3O.
What is the molecular weight of the compound?
The molecular weight of the compound is 255.03 g/mol.
What is the IUPAC Name of the compound?
The IUPAC name of the compound is [2-bromo-5-(trifluoromethyl)phenyl]methanol.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C8H6BrF3O/c9-7-2-1-6(8(10,11)12)3-5(7)4-13/h1-3,13H,4H2.
What is the InChIKey of the compound?
The InChIKey of the compound is RXASTJJSPATSHH-UHFFFAOYSA-N.
What is the Canonical SMILES of the compound?
The Canonical SMILES of the compound is C1=CC(=C(C=C1C(F)(F)F)CO)Br.
What is the CAS number of the compound?
The CAS number of the compound is 869725-53-1.
What is the European Community (EC) Number of the compound?
The European Community (EC) Number of the compound is 800-088-8.
What is the XLogP3-AA value of the compound?
The XLogP3-AA value of the compound is 2.6.
Is the compound canonicalized?
Yes, the compound is canonicalized.
Recommended Products
