CAS
573675-31-7 Purity
---
573675-31-7 Purity
---
Inquiry Basket
2-Bromo-4-chlorophenylacetic acid
CAS
52864-56-9
Catalog Number
ACM52864569
Category
Bromine Series
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 2-Bromo-4-chlorophenylacetic acid?
The molecular formula of 2-Bromo-4-chlorophenylacetic acid is C8H6BrClO2.
What is the molecular weight of 2-Bromo-4-chlorophenylacetic acid?
The molecular weight of 2-Bromo-4-chlorophenylacetic acid is 249.49 g/mol.
What is the IUPAC name of 2-Bromo-4-chlorophenylacetic acid?
The IUPAC name of 2-Bromo-4-chlorophenylacetic acid is 2-(2-bromo-4-chlorophenyl)acetic acid.
What is the InChI of 2-Bromo-4-chlorophenylacetic acid?
The InChI of 2-Bromo-4-chlorophenylacetic acid is InChI=1S/C8H6BrClO2/c9-7-4-6(10)2-1-5(7)3-8(11)12/h1-2,4H,3H2,(H,11,12).
What is the InChIKey of 2-Bromo-4-chlorophenylacetic acid?
The InChIKey of 2-Bromo-4-chlorophenylacetic acid is BWAQWLHENYXBOQ-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Bromo-4-chlorophenylacetic acid?
The canonical SMILES of 2-Bromo-4-chlorophenylacetic acid is C1=CC(=C(C=C1Cl)Br)CC(=O)O.
What is the CAS number of 2-Bromo-4-chlorophenylacetic acid?
The CAS number of 2-Bromo-4-chlorophenylacetic acid is 52864-56-9.
What is the XLogP3-AA value of 2-Bromo-4-chlorophenylacetic acid?
The XLogP3-AA value of 2-Bromo-4-chlorophenylacetic acid is 2.7.
What is the hydrogen bond donor count of 2-Bromo-4-chlorophenylacetic acid?
The hydrogen bond donor count of 2-Bromo-4-chlorophenylacetic acid is 1.
Is 2-Bromo-4-chlorophenylacetic acid a canonicalized compound?
Yes, 2-Bromo-4-chlorophenylacetic acid is a canonicalized compound.
Recommended Products
![7-Bromo-4-chloropyrido[3,2-d]pyrimidine](https://resource.alfa-chemistry.com/structure/573675-31-7.gif)
