2-Amino-5-[(trimethylsilyl)ethynyl]pyridine

• CAS: 457628-40-9
• Catalog Number: ACM457628409
• Category: Other Organosilicon
• Molecular Weight: 190.32
• Molecular Formula: C₁₀H₁₄N₂Si
• Appearance: Transparent liquid

Custom Q&A

What is the molecular formula of the compound?

The molecular formula of the compound is C10H14N2Si.

What is the molecular weight of the compound?

The molecular weight of the compound is 190.32 g/mol.

What is the IUPAC name of the compound?

The IUPAC name of the compound is 5-(2-trimethylsilylethynyl)pyridin-2-amine.

What is the InChI of the compound?

The InChI of the compound is InChI=1S/C10H14N2Si/c1-13(2,3)7-6-9-4-5-10(11)12-8-9/h4-5,8H,1-3H3,(H2,11,12).

What is the InChIKey of the compound?

The InChIKey of the compound is YWOSXPDVPWMKJU-UHFFFAOYSA-N.

What is the canonical SMILES of the compound?

The canonical SMILES of the compound is C[Si](C)(C)C#CC1=CN=C(C=C1)N.

What is the CAS number of the compound?

The CAS number of the compound is 457628-40-9.

What is the European Community (EC) number of the compound?

The European Community (EC) number of the compound is 801-484-3.

What is the hydrogen bond donor count of the compound?

The hydrogen bond donor count of the compound is 1.

Is the compound canonicalized?

Yes, the compound is canonicalized.