What is the molecular formula of 2-Amino-3-nitropyridine-5-boronic acid pinacol ester?
The molecular formula is C11H16BN3O4.
When was 2-Amino-3-nitropyridine-5-boronic acid pinacol ester created?
It was created on July 26, 2010.
What is the IUPAC name of 2-Amino-3-nitropyridine-5-boronic acid pinacol ester?
The IUPAC name is 3-nitro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine.
What is the InChI of 2-Amino-3-nitropyridine-5-boronic acid pinacol ester?
The InChI is InChI=1S/C11H16BN3O4/c1-10(2)11(3,4)19-12(18-10)7-5-8(15(16)17)9(13)14-6-7/h5-6H,1-4H3,(H2,13,14).
What is the InChIKey of 2-Amino-3-nitropyridine-5-boronic acid pinacol ester?
The InChIKey is HXMCKJVPNJJZTO-UHFFFAOYSA-N.
What is the Canonical SMILES representation of 2-Amino-3-nitropyridine-5-boronic acid pinacol ester?
The Canonical SMILES is B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(N=C2)N)[N+](=O)[O-].
What is the CAS number of 2-Amino-3-nitropyridine-5-boronic acid pinacol ester?
The CAS number is 1032758-80-7.
How many hydrogen bond donor counts does 2-Amino-3-nitropyridine-5-boronic acid pinacol ester have?
It has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does 2-Amino-3-nitropyridine-5-boronic acid pinacol ester have?
It has 6 hydrogen bond acceptor counts.
What is the topological polar surface area of 2-Amino-3-nitropyridine-5-boronic acid pinacol ester?
The topological polar surface area is 103Ų.