2-amino-3-cyano-5-methyl thiophen

• CAS: 138564-58-6
• Catalog Number: ACM138564586
• Category: Thiophenes
• Molecular Weight: 158.17
• Molecular Formula: C5H6N2O2S
• Synonyms: 2-Amino-5-Methyl-3-Nitrothiophene; 2-Amino-3-cyano-5-methyl

Custom Q&A

What is the molecular formula of the compound?

The molecular formula of the compound is C6H6N2S.

What is the molecular weight of the compound?

The molecular weight of the compound is 138.19 g/mol.

What is the IUPAC name of the compound?

The IUPAC name of the compound is 2-amino-5-methylthiophene-3-carbonitrile.

What is the InChI of the compound?

The InChI of the compound is InChI=1S/C6H6N2S/c1-4-2-5(3-7)6(8)9-4/h2H,8H2,1H3.

What is the InChIKey of the compound?

The InChIKey of the compound is YGXADLPRHBRTPG-UHFFFAOYSA-N.

What is the canonical SMILES of the compound?

The canonical SMILES of the compound is CC1=CC(=C(S1)N)C#N.

What is the CAS number of the compound?

The CAS number of the compound is 138564-58-6.

What is the European Community (EC) number of the compound?

The European Community (EC) number of the compound is 604-082-4.

What is the UNII of the compound?

The UNII of the compound is VK4FNV7HCG.

Is the compound canonicalized?

Yes, the compound is canonicalized.