2,6-Dichloro-3-nitrophenylboronic acid

• CAS: 1072946-37-2
• Catalog Number: ACM1072946372
• Category: Other Products; Boronic Acids
• Molecular Weight: 235.8
• Molecular Formula: C₆H₄BCl₂NO₄
• Synonyms: 2,6-Dichloro-3-nitrophenylboronic acid, 1072946-37-2, (2,6-Dichloro-3-nitrophenyl)boronic acid, ACMC-2098s0, CTK4A5252, ANW-15646, AKOS015849928, AG-D-22499, 2,6-Dichloro-3-nitrophenylboronic acid,, AK-42329, KB-18173, X1544, A-4568, I04-2453
• IUPAC Name: (2,6-dichloro-3-nitrophenyl)boronic acid
• Canonical SMILES: B(C1=C(C=CC(=C1Cl)[N+](=O)[O-])Cl)(O)O
• InChI Key: ZLBSACXTTUJLJN-UHFFFAOYSA-N
• Exact Mass: 234.96100
• H-Bond Acceptor: 4
• H-Bond Donor: 2

Custom Q&A

What is the molecular formula of 2,6-Dichloro-3-nitrophenylboronic acid?

The molecular formula of 2,6-Dichloro-3-nitrophenylboronic acid is C6H4BCl2NO4.

What is the molecular weight of 2,6-Dichloro-3-nitrophenylboronic acid?

The molecular weight of 2,6-Dichloro-3-nitrophenylboronic acid is 235.82 g/mol.

What is the IUPAC name of 2,6-Dichloro-3-nitrophenylboronic acid?

The IUPAC name of 2,6-Dichloro-3-nitrophenylboronic acid is (2,6-dichloro-3-nitrophenyl)boronic acid.

What is the InChI of 2,6-Dichloro-3-nitrophenylboronic acid?

The InChI of 2,6-Dichloro-3-nitrophenylboronic acid is InChI=1S/C6H4BCl2NO4/c8-3-1-2-4(10(13)14)6(9)5(3)7(11)12/h1-2,11-12H.

What is the InChIKey of 2,6-Dichloro-3-nitrophenylboronic acid?

The InChIKey of 2,6-Dichloro-3-nitrophenylboronic acid is ZLBSACXTTUJLJN-UHFFFAOYSA-N.

What is the canonical SMILES of 2,6-Dichloro-3-nitrophenylboronic acid?

The canonical SMILES of 2,6-Dichloro-3-nitrophenylboronic acid is B(C1=C(C=CC(=C1Cl)[N+](=O)[O-])Cl)(O)O.

What is the CAS number of 2,6-Dichloro-3-nitrophenylboronic acid?

The CAS number of 2,6-Dichloro-3-nitrophenylboronic acid is 1072946-37-2.

What is the hydrogen bond donor count of 2,6-Dichloro-3-nitrophenylboronic acid?

The hydrogen bond donor count of 2,6-Dichloro-3-nitrophenylboronic acid is 2.

What is the hydrogen bond acceptor count of 2,6-Dichloro-3-nitrophenylboronic acid?

The hydrogen bond acceptor count of 2,6-Dichloro-3-nitrophenylboronic acid is 4.

What is the rotatable bond count of 2,6-Dichloro-3-nitrophenylboronic acid?

The rotatable bond count of 2,6-Dichloro-3-nitrophenylboronic acid is 1.