2,6-Bis(trifluoromethyl)phenylboronic acid

• CAS: 681812-07-7
• Catalog Number: ACM681812077-1
• Category: Boronic Acids

Custom Q&A

What is the molecular formula of 2,6-Bis(trifluoromethyl)phenylboronic acid?

The molecular formula is C8H5BF6O2.

What is the molecular weight of 2,6-Bis(trifluoromethyl)phenylboronic acid?

The molecular weight is 257.93 g/mol.

What is the IUPAC name of 2,6-Bis(trifluoromethyl)phenylboronic acid?

The IUPAC name is [2,6-bis(trifluoromethyl)phenyl]boronic acid.

What is the InChIKey of 2,6-Bis(trifluoromethyl)phenylboronic acid?

The InChIKey is WAMPGNNEOZGBHR-UHFFFAOYSA-N.

What is the Canonical SMILES representation of 2,6-Bis(trifluoromethyl)phenylboronic acid?

The Canonical SMILES is B(C1=C(C=CC=C1C(F)(F)F)C(F)(F)F)(O)O.

How many hydrogen bond donor counts does 2,6-Bis(trifluoromethyl)phenylboronic acid have?

It has 2 hydrogen bond donor counts.

What is the topological polar surface area of 2,6-Bis(trifluoromethyl)phenylboronic acid?

The topological polar surface area is 40.5Ų.

How many rotatable bond counts does 2,6-Bis(trifluoromethyl)phenylboronic acid have?

It has 1 rotatable bond count.

Is the compound canonicalized?

Yes, the compound is canonicalized.

What is the exact mass and monoisotopic mass of 2,6-Bis(trifluoromethyl)phenylboronic acid?

The exact mass and monoisotopic mass are both 258.0286785 g/mol.