CAS
957060-82-1 Purity
98%
957060-82-1 Purity
98%
Inquiry Basket
2,4-Dichloro-3-cyanophenylboronic acid
CAS
957120-87-5
Catalog Number
ACM957120875
Category
Other Products; Boronic Acids
Molecular Formula
C7H4BCl2NO2
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 2,4-Dichloro-3-cyanophenylboronic acid?
The molecular formula of 2,4-Dichloro-3-cyanophenylboronic acid is C7H4BCl2NO2.
What is the molecular weight of 2,4-Dichloro-3-cyanophenylboronic acid?
The molecular weight of 2,4-Dichloro-3-cyanophenylboronic acid is 215.83 g/mol.
What is the IUPAC name of 2,4-Dichloro-3-cyanophenylboronic acid?
The IUPAC name of 2,4-Dichloro-3-cyanophenylboronic acid is (2,4-dichloro-3-cyanophenyl)boronic acid.
What is the InChI of 2,4-Dichloro-3-cyanophenylboronic acid?
The InChI of 2,4-Dichloro-3-cyanophenylboronic acid is InChI=1S/C7H4BCl2NO2/c9-6-2-1-5(8(12)13)7(10)4(6)3-11/h1-2,12-13H.
What is the InChIKey of 2,4-Dichloro-3-cyanophenylboronic acid?
The InChIKey of 2,4-Dichloro-3-cyanophenylboronic acid is FFNJVSXDMXUODJ-UHFFFAOYSA-N.
What is the canonical SMILES of 2,4-Dichloro-3-cyanophenylboronic acid?
The canonical SMILES of 2,4-Dichloro-3-cyanophenylboronic acid is B(C1=C(C(=C(C=C1)Cl)C#N)Cl)(O)O.
What is the CAS number of 2,4-Dichloro-3-cyanophenylboronic acid?
The CAS number of 2,4-Dichloro-3-cyanophenylboronic acid is 957120-87-5.
What is the hydrogen bond donor count of 2,4-Dichloro-3-cyanophenylboronic acid?
The hydrogen bond donor count of 2,4-Dichloro-3-cyanophenylboronic acid is 2.
What is the hydrogen bond acceptor count of 2,4-Dichloro-3-cyanophenylboronic acid?
The hydrogen bond acceptor count of 2,4-Dichloro-3-cyanophenylboronic acid is 3.
Is 2,4-Dichloro-3-cyanophenylboronic acid a canonicalized compound?
Yes, 2,4-Dichloro-3-cyanophenylboronic acid is canonicalized.
Recommended Products
