CAS
946002-10-4 Purity
95%
946002-10-4 Purity
95%
Inquiry Basket
2,3-Difluoro-5-nitrophenylboronic acid
CAS
957060-82-1
Catalog Number
ACM957060821
Category
Other Products; Boronic Acids
Molecular Formula
C6H4BF2NO4
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 2,3-Difluoro-5-nitrophenylboronic acid?
The molecular formula of 2,3-Difluoro-5-nitrophenylboronic acid is C6H4BF2NO4.
What is the molecular weight of 2,3-Difluoro-5-nitrophenylboronic acid?
The molecular weight of 2,3-Difluoro-5-nitrophenylboronic acid is 202.91 g/mol.
What is the IUPAC name of 2,3-Difluoro-5-nitrophenylboronic acid?
The IUPAC name of 2,3-Difluoro-5-nitrophenylboronic acid is (2,3-difluoro-5-nitrophenyl)boronic acid.
What is the InChI of 2,3-Difluoro-5-nitrophenylboronic acid?
The InChI of 2,3-Difluoro-5-nitrophenylboronic acid is InChI=1S/C6H4BF2NO4/c8-5-2-3(10(13)14)1-4(6(5)9)7(11)12/h1-2,11-12H.
What is the InChIKey of 2,3-Difluoro-5-nitrophenylboronic acid?
The InChIKey of 2,3-Difluoro-5-nitrophenylboronic acid is AARSYRVYLRWEBG-UHFFFAOYSA-N.
What is the canonical SMILES of 2,3-Difluoro-5-nitrophenylboronic acid?
The canonical SMILES of 2,3-Difluoro-5-nitrophenylboronic acid is B(C1=CC(=CC(=C1F)F)[N+](=O)[O-])(O)O.
What is the CAS number of 2,3-Difluoro-5-nitrophenylboronic acid?
The CAS number of 2,3-Difluoro-5-nitrophenylboronic acid is 957060-82-1.
How many hydrogen bond donor counts does 2,3-Difluoro-5-nitrophenylboronic acid have?
2,3-Difluoro-5-nitrophenylboronic acid has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 2,3-Difluoro-5-nitrophenylboronic acid have?
2,3-Difluoro-5-nitrophenylboronic acid has 6 hydrogen bond acceptor counts.
How many rotatable bond counts does 2,3-Difluoro-5-nitrophenylboronic acid have?
2,3-Difluoro-5-nitrophenylboronic acid has 1 rotatable bond count.
Recommended Products
