2,2-difluoro-2-(furan-2-yl)acetic acid

• CAS: 1344257-62-0
• Catalog Number: ACM1344257620
• Category: Furans
• Molecular Weight: 162.09
• Molecular Formula: C6H4F2O3

Custom Q&A

What is the molecular formula of 2,2-difluoro-2-(furan-2-yl)acetic acid?

The molecular formula of 2,2-difluoro-2-(furan-2-yl)acetic acid is C6H4F2O3.

What is the molecular weight of 2,2-difluoro-2-(furan-2-yl)acetic acid?

The molecular weight of 2,2-difluoro-2-(furan-2-yl)acetic acid is 162.09 g/mol.

What is the IUPAC name of 2,2-difluoro-2-(furan-2-yl)acetic acid?

The IUPAC name of 2,2-difluoro-2-(furan-2-yl)acetic acid is 2,2-difluoro-2-(furan-2-yl)acetic acid.

What is the InChI of 2,2-difluoro-2-(furan-2-yl)acetic acid?

The InChI of 2,2-difluoro-2-(furan-2-yl)acetic acid is InChI=1S/C6H4F2O3/c7-6(8,5(9)10)4-2-1-3-11-4/h1-3H,(H,9,10).

What is the InChIKey of 2,2-difluoro-2-(furan-2-yl)acetic acid?

The InChIKey of 2,2-difluoro-2-(furan-2-yl)acetic acid is DPDDTDUSQNUSAZ-UHFFFAOYSA-N.

What is the canonical SMILES of 2,2-difluoro-2-(furan-2-yl)acetic acid?

The canonical SMILES of 2,2-difluoro-2-(furan-2-yl)acetic acid is C1=COC(=C1)C(C(=O)O)(F)F.

What is the XLogP3-AA value of 2,2-difluoro-2-(furan-2-yl)acetic acid?

The XLogP3-AA value of 2,2-difluoro-2-(furan-2-yl)acetic acid is 1.2.

How many hydrogen bond donor counts does 2,2-difluoro-2-(furan-2-yl)acetic acid have?

2,2-difluoro-2-(furan-2-yl)acetic acid has 1 hydrogen bond donor count.

How many hydrogen bond acceptor counts does 2,2-difluoro-2-(furan-2-yl)acetic acid have?

2,2-difluoro-2-(furan-2-yl)acetic acid has 5 hydrogen bond acceptor counts.

How many rotatable bond counts does 2,2-difluoro-2-(furan-2-yl)acetic acid have?

2,2-difluoro-2-(furan-2-yl)acetic acid has 2 rotatable bond counts.