1H-Pyrrolo[2,3-B]pyridine-5-boronicacid

• CAS: 944059-24-9
• Catalog Number: ACM944059249
• Category: Boro-Amino Acids
• Synonyms: Boronic acid, B-1H-pyrrolo[2,3-b]pyridin-5-yl-;1H-pyrrolo[2,3-b]pyridin-5-yl-5-boronic acid;7-Azaindole-5-boronic acid

Custom Q&A

What is the molecular formula of 1H-Pyrrolo[2,3-B]pyridine-5-boronic acid according to the reference?

The molecular formula is C7H7BN2O2.

When was 1H-Pyrrolo[2,3-B]pyridine-5-boronic acid created and last modified?

It was created on 2010-06-03 and last modified on 2023-12-02.

What is the IUPAC name of 1H-Pyrrolo[2,3-B]pyridine-5-boronic acid?

The IUPAC name is 1H-pyrrolo[2,3-b]pyridin-5-ylboronic acid.

What is the InChI of 1H-Pyrrolo[2,3-B]pyridine-5-boronic acid?

The InChI is InChI=1S/C7H7BN2O2/c11-8(12)6-3-5-1-2-9-7(5)10-4-6/h1-4,11-12H,(H,9,10).

What is the molecular weight of 1H-Pyrrolo[2,3-B]pyridine-5-boronic acid?

The molecular weight is 161.96 g/mol.

How many hydrogen bond donor counts does 1H-Pyrrolo[2,3-B]pyridine-5-boronic acid have?

It has 3 hydrogen bond donor counts.

What is the topological polar surface area of 1H-Pyrrolo[2,3-B]pyridine-5-boronic acid?

The topological polar surface area is 69.1Ų.

How many heavy atoms are there in 1H-Pyrrolo[2,3-B]pyridine-5-boronic acid?

There are 12 heavy atoms.

Is 1H-Pyrrolo[2,3-B]pyridine-5-boronic acid a canonicalized compound?

Yes, it is a canonicalized compound.

What is the exact mass and monoistopic mass of 1H-Pyrrolo[2,3-B]pyridine-5-boronic acid?

The exact mass and monoistopic mass is 162.0600576 g/mol.