1H,1H,2H,2H-Perfluorooctyl acrylate

• CAS: 17527-29-6
• Catalog Number: ACM17527296
• Category: Polymer/Macromolecule
• Molecular Weight: 418.15
• Molecular Formula: C₁₁H₇F₁₃O₂
• Synonyms: 1H,1H,2H,2H-PERFLUOROOCTYL ACRYLATE;3,3,4,4,5,5,6,6,7,7,8,8,8-TRIDECAFLUOROOCTYL ACRYLATE;2-(PERFLUOROHEXYL)ETHYL ACRYLATE;1,1,2,2-Tetrahydroperfluorooctylacrylate;2-Propenoicacid,3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylester;1H,1H,2H,2H-Perfluoroocty

Custom Q&A

What is the molecular formula of 1H,1H,2H,2H-Perfluorooctyl acrylate?

The molecular formula of 1H,1H,2H,2H-Perfluorooctyl acrylate is C11H7F13O2.

What is the molecular weight of 1H,1H,2H,2H-Perfluorooctyl acrylate?

The molecular weight of 1H,1H,2H,2H-Perfluorooctyl acrylate is 418.15 g/mol.

What is the IUPAC Name of 1H,1H,2H,2H-Perfluorooctyl acrylate?

The IUPAC Name is 3,3,4,4,5,5,6,6,7,7,8,8,8-Tridecafluorooctyl prop-2-enoate.

What is the InChIKey of 1H,1H,2H,2H-Perfluorooctyl acrylate?

The InChIKey is VPKQPPJQTZJZDB-UHFFFAOYSA-N.

What is the Canonical SMILES of 1H,1H,2H,2H-Perfluorooctyl acrylate?

The Canonical SMILES is C=CC(=O)OCCC(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F.

What is the CAS number for 1H,1H,2H,2H-Perfluorooctyl acrylate?

The CAS number is 17527-29-6.

How many hydrogen bond acceptor counts does 1H,1H,2H,2H-Perfluorooctyl acrylate have?

1H,1H,2H,2H-Perfluorooctyl acrylate has 15 hydrogen bond acceptor counts.

What is the topological polar surface area of 1H,1H,2H,2H-Perfluorooctyl acrylate?

The topological polar surface area is 26.3Ų.

How many rotatable bond counts does 1H,1H,2H,2H-Perfluorooctyl acrylate have?

1H,1H,2H,2H-Perfluorooctyl acrylate has 9 rotatable bond counts.

What is the complexity of 1H,1H,2H,2H-Perfluorooctyl acrylate?

The complexity is 535.