CAS
--- Purity
≥98%
--- Purity
≥98%
Inquiry Basket
1-octyl-3-methylimidazolium perchlorate
Catalog Number
ACMA00003680
Category
Imidazolium Ionic Liquids
Molecular Weight
294.77502
Molecular Formula
C12H23O4N2Cl
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
Specification
Abbreviation
OMIMClO4
Chemical Formula
[OMIm] ClO4
What is the molecular formula of 1-octyl-3-methylimidazolium perchlorate?
The molecular formula is C12H23ClN2O4.
What is the molecular weight of 1-octyl-3-methylimidazolium perchlorate?
The molecular weight is 294.77 g/mol.
When was 1-octyl-3-methylimidazolium perchlorate created in PubChem?
It was created on July 14, 2016.
What is the IUPAC name of 1-octyl-3-methylimidazolium perchlorate?
The IUPAC name is 1-methyl-3-octylimidazol-1-ium;perchlorate.
What is the Canonical SMILES of 1-octyl-3-methylimidazolium perchlorate?
The Canonical SMILES is CCCCCCCCN1C=C[N+](=C1)C.[O-]Cl(=O)(=O)=O.
How many hydrogen bond donor counts are there in 1-octyl-3-methylimidazolium perchlorate?
There are 0 hydrogen bond donor counts.
What is the hydrogen bond acceptor count in 1-octyl-3-methylimidazolium perchlorate?
The hydrogen bond acceptor count is 4.
What is the exact mass of 1-octyl-3-methylimidazolium perchlorate?
The exact mass is 294.1346349 g/mol.
How many rotatable bond counts are there in 1-octyl-3-methylimidazolium perchlorate?
There are 7 rotatable bond counts.
Is 1-octyl-3-methylimidazolium perchlorate a canonicalized compound?
Yes, the compound is canonicalized.
Recommended Products
