1-hexyl-3-methylimidazolium dihydrogen phosphate

• CAS: 922521-04-8
• Catalog Number: ACM922521048
• Category: Imidazolium Ionic Liquids
• Molecular Weight: 264.25
• Molecular Formula: C10H21O4N2P
• Abbreviation: HMIMH2PO4
• Chemical Formula: HMIMH2PO4

Custom Q&A

What is the molecular formula of the compound?

The molecular formula of the compound is C12H27N2O4P.

What are the synonyms of the compound?

The synonyms of the compound are 922521-04-8, 1-HEXYL-3-METHYLIMIDAZOLIUM DIHYDROGEN PHOSPHATE, DTXSID30854896, dihydrogen phosphate;1-methyl-3-octyl-1,2-dihydroimidazol-1-ium, 1-Methyl-3-octyl-2,3-dihydro-1H-imidazol-1-ium dihydrogen phosphate.

What is the molecular weight of the compound?

The molecular weight of the compound is 294.33 g/mol.

What is the IUPAC name of the compound?

The IUPAC name of the compound is dihydrogen phosphate;1-methyl-3-octyl-1,2-dihydroimidazol-1-ium.

What is the InChI of the compound?

The InChI of the compound is InChI=1S/C12H24N2.H3O4P/c1-3-4-5-6-7-8-9-14-11-10-13(2)12-14;1-5(2,3)4/h10-11H,3-9,12H2,1-2H3;(H3,1,2,3,4).

What is the InChIKey of the compound?

The InChIKey of the compound is LJNSGLVUYMKVKE-UHFFFAOYSA-N.

What is the canonical SMILES of the compound?

The canonical SMILES of the compound is CCCCCCCCN1C[NH+](C=C1)C.OP(=O)(O)[O-].

What is the CAS number of the compound?

The CAS number of the compound is 922521-04-8.

What is the hydrogen bond donor count of the compound?

The hydrogen bond donor count of the compound is 3.

Is the compound canonicalized?

Yes, the compound is canonicalized.