1-Chloro-1-methyl-silacyclopent-3-ene

• CAS: 24429-73-0
• Catalog Number: ACM24429730
• Category: Halosilane
• Molecular Weight: 132.66
• Molecular Formula: C₅H₉ClSi
• Appearance: Transparent liquid

Custom Q&A

What is the molecular formula of 1-Chloro-1-methyl-silacyclopent-3-ene?

The molecular formula is C5H9ClSi.

What is the molecular weight of 1-Chloro-1-methyl-silacyclopent-3-ene?

The molecular weight is 132.66 g/mol.

What is the IUPAC name of 1-Chloro-1-methyl-silacyclopent-3-ene?

The IUPAC name is 1-chloro-1-methyl-2,5-dihydrosilole.

What is the InChI of 1-Chloro-1-methyl-silacyclopent-3-ene?

The InChI is InChI=1S/C5H9ClSi/c1-7(6)4-2-3-5-7/h2-3H,4-5H2,1H3.

What is the InChIKey of 1-Chloro-1-methyl-silacyclopent-3-ene?

The InChIKey is IDNUVEQSYGHPML-UHFFFAOYSA-N.

What is the canonical SMILES of 1-Chloro-1-methyl-silacyclopent-3-ene?

The canonical SMILES is C[Si]1(CC=CC1)Cl.

What is the hydrogen bond donor count of 1-Chloro-1-methyl-silacyclopent-3-ene?

The hydrogen bond donor count is 0.

What is the hydrogen bond acceptor count of 1-Chloro-1-methyl-silacyclopent-3-ene?

The hydrogen bond acceptor count is 0.

What is the rotatable bond count of 1-Chloro-1-methyl-silacyclopent-3-ene?

The rotatable bond count is 0.

Is 1-Chloro-1-methyl-silacyclopent-3-ene a canonicalized compound?

Yes, 1-Chloro-1-methyl-silacyclopent-3-ene is canonicalized.