1-butyl-3-vinylimidazolium chloride

• CAS: 657394-65-5
• Catalog Number: ACM657394655
• Category: Main Products
• Molecular Weight: 186.68
• Molecular Formula: C9H15N2Cl
• Synonyms: 1-Vinyl-3-ButylImidazolium Chloride
• Appearance: Liquid
• Chemical Formula: VBIMCl

Custom Q&A

What is the molecular formula of 1-butyl-3-vinylimidazolium chloride?

The molecular formula of 1-butyl-3-vinylimidazolium chloride is C9H15ClN2.

What is the molecular weight of 1-butyl-3-vinylimidazolium chloride?

The molecular weight of 1-butyl-3-vinylimidazolium chloride is 186.68 g/mol.

What is the IUPAC name of 1-butyl-3-vinylimidazolium chloride?

The IUPAC name of 1-butyl-3-vinylimidazolium chloride is 1-butyl-3-ethenylimidazol-1-ium chloride.

What is the InChI of 1-butyl-3-vinylimidazolium chloride?

The InChI of 1-butyl-3-vinylimidazolium chloride is InChI=1S/C9H15N2.ClH/c1-3-5-6-11-8-7-10(4-2)9-11;/h4,7-9H,2-3,5-6H2,1H3;1H/q+1;/p-1.

What is the InChIKey of 1-butyl-3-vinylimidazolium chloride?

The InChIKey of 1-butyl-3-vinylimidazolium chloride is KRCYUCRTMSTHOK-UHFFFAOYSA-M.

What is the canonical SMILES of 1-butyl-3-vinylimidazolium chloride?

The canonical SMILES of 1-butyl-3-vinylimidazolium chloride is CCCC[N+]1=CN(C=C1)C=C.[Cl-].

How many hydrogen bond donor count does 1-butyl-3-vinylimidazolium chloride have?

1-butyl-3-vinylimidazolium chloride has 0 hydrogen bond donor count.

How many hydrogen bond acceptor count does 1-butyl-3-vinylimidazolium chloride have?

1-butyl-3-vinylimidazolium chloride has 1 hydrogen bond acceptor count.

How many rotatable bond count does 1-butyl-3-vinylimidazolium chloride have?

1-butyl-3-vinylimidazolium chloride has 4 rotatable bond count.

What is the topological polar surface area of 1-butyl-3-vinylimidazolium chloride?

The topological polar surface area of 1-butyl-3-vinylimidazolium chloride is 8.8 ?2.