CAS
886372-98-1 Purity
96%
886372-98-1 Purity
96%
Inquiry Basket
1-Bromo-3-fluoro-2-nitrobenzene
CAS
886762-70-5
Catalog Number
ACM886762705
Category
Bromine Series
Molecular Formula
C6H3BrFNO2
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 1-Bromo-3-fluoro-2-nitrobenzene?
The molecular formula of 1-Bromo-3-fluoro-2-nitrobenzene is C6H3BrFNO2.
What is the molecular weight of 1-Bromo-3-fluoro-2-nitrobenzene?
The molecular weight of 1-Bromo-3-fluoro-2-nitrobenzene is 220.00 g/mol.
What is the IUPAC name of 1-Bromo-3-fluoro-2-nitrobenzene?
The IUPAC name of 1-Bromo-3-fluoro-2-nitrobenzene is 1-bromo-3-fluoro-2-nitrobenzene.
What is the Canonical SMILES of 1-Bromo-3-fluoro-2-nitrobenzene?
The Canonical SMILES of 1-Bromo-3-fluoro-2-nitrobenzene is C1=CC(=C(C(=C1)Br)[N+](=O)[O-])F.
What is the CAS number of 1-Bromo-3-fluoro-2-nitrobenzene?
The CAS number of 1-Bromo-3-fluoro-2-nitrobenzene is 886762-70-5.
What is the XLogP3-AA value of 1-Bromo-3-fluoro-2-nitrobenzene?
The XLogP3-AA value of 1-Bromo-3-fluoro-2-nitrobenzene is 2.5.
How many hydrogen bond donor counts does 1-Bromo-3-fluoro-2-nitrobenzene have?
1-Bromo-3-fluoro-2-nitrobenzene has 0 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 1-Bromo-3-fluoro-2-nitrobenzene have?
1-Bromo-3-fluoro-2-nitrobenzene has 3 hydrogen bond acceptor counts.
How many rotatable bond counts does 1-Bromo-3-fluoro-2-nitrobenzene have?
1-Bromo-3-fluoro-2-nitrobenzene has 0 rotatable bond counts.
What is the topological polar surface area of 1-Bromo-3-fluoro-2-nitrobenzene?
The topological polar surface area of 1-Bromo-3-fluoro-2-nitrobenzene is 45.8Ų.
Recommended Products
