CAS
6968-24-7 Purity
98%
6968-24-7 Purity
98%
Inquiry Basket
1-Amino-4-bromoisoquinoline
CAS
55270-27-4
Catalog Number
ACM55270274-1
Category
Bromine Series
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 1-Amino-4-bromoisoquinoline?
The molecular formula of 1-Amino-4-bromoisoquinoline is C9H7BrN2.
What is the molecular weight of 1-Amino-4-bromoisoquinoline?
The molecular weight of 1-Amino-4-bromoisoquinoline is 223.07 g/mol.
What is the IUPAC name of 1-Amino-4-bromoisoquinoline?
The IUPAC name of 1-Amino-4-bromoisoquinoline is 4-bromoisoquinolin-1-amine.
What is the InChI of 1-Amino-4-bromoisoquinoline?
The InChI of 1-Amino-4-bromoisoquinoline is InChI=1S/C9H7BrN2/c10-8-5-12-9(11)7-4-2-1-3-6(7)8/h1-5H,(H2,11,12).
What is the InChIKey of 1-Amino-4-bromoisoquinoline?
The InChIKey of 1-Amino-4-bromoisoquinoline is YWOLBIUYICZCLK-UHFFFAOYSA-N.
What is the canonical SMILES of 1-Amino-4-bromoisoquinoline?
The canonical SMILES of 1-Amino-4-bromoisoquinoline is C1=CC=C2C(=C1)C(=CN=C2N)Br.
What is the CAS number of 1-Amino-4-bromoisoquinoline?
The CAS number of 1-Amino-4-bromoisoquinoline is 55270-27-4.
What is the XLogP3-AA value of 1-Amino-4-bromoisoquinoline?
The XLogP3-AA value of 1-Amino-4-bromoisoquinoline is 2.4.
How many hydrogen bond donor counts does 1-Amino-4-bromoisoquinoline have?
1-Amino-4-bromoisoquinoline has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does 1-Amino-4-bromoisoquinoline have?
1-Amino-4-bromoisoquinoline has 2 hydrogen bond acceptor counts.
Recommended Products
