CAS
64421-69-8 Purity
---
64421-69-8 Purity
---
Inquiry Basket
1-(3-bromopropyl)-4-chlorobenzene
CAS
64473-35-4
Catalog Number
ACM64473354
Category
Other Products; Bromine Series
Molecular Formula
C9H10BrCl
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
May 23, 2023
Work well in orgaorganic synthesis.
As an organic intermediate, 1-(3-bromopropyl)-4-chlorobenzene can introduce aryl groups to synthesize organic molecules.
What is the IUPAC name of the compound?
The IUPAC name of the compound is 1-(3-bromopropyl)-4-chlorobenzene.
What is the molecular formula of the compound?
The molecular formula of the compound is C9H10BrCl.
What is the molecular weight of the compound?
The molecular weight of the compound is 233.53 g/mol.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C9H10BrCl/c10-7-1-2-8-3-5-9(11)6-4-8/h3-6H,1-2,7H2.
What is the InChIKey of the compound?
The InChIKey of the compound is OVXYDNVSUOXGQG-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is C1=CC(=CC=C1CCCBr)Cl.
What is the CAS number of the compound?
The CAS number of the compound is 64473-35-4.
What is the XLogP3-AA value of the compound?
The XLogP3-AA value of the compound is 3.9.
How many rotatable bonds does the compound have?
The compound has 3 rotatable bonds.
Is the compound a canonicalized compound?
Yes, the compound is canonicalized.
Recommended Products
