1,3-Bis(Triethoxysilylethyl)Tetramethyldisiloxane

• CAS: 117680-21-4
• Catalog Number: ACM117680214
• Category: Siloxanes
• Molecular Weight: 514.95 g/mol
• Molecular Formula: C20H50O7Si4
• Appearance: Transparent liquid
• Packaging: 10 g; 100 g

Custom Q&A

What is the molecular formula of 1,3-Bis(triethoxysilylethyl)tetramethyldisiloxane?

The molecular formula is C20H50O7Si4.

What is the molecular weight of 1,3-Bis(triethoxysilylethyl)tetramethyldisiloxane?

The molecular weight is 514.9 g/mol.

What is the IUPAC name of 1,3-Bis(triethoxysilylethyl)tetramethyldisiloxane?

The IUPAC name is [dimethyl(2-triethoxysilylethyl)silyl]oxy-dimethyl-(2-triethoxysilylethyl)silane.

What is the InChI of 1,3-Bis(triethoxysilylethyl)tetramethyldisiloxane?

The InChI is InChI=1S/C20H50O7Si4/c1-11-21-30(22-12-2,23-13-3)19-17-28(7,8)27-29(9,10)18-20-31(24-14-4,25-15-5)26-16-6/h11-20H2,1-10H3.

What is the InChIKey of 1,3-Bis(triethoxysilylethyl)tetramethyldisiloxane?

The InChIKey is JQCCEDUTYZNWDO-UHFFFAOYSA-N.

What is the Canonical SMILES of 1,3-Bis(triethoxysilylethyl)tetramethyldisiloxane?

The Canonical SMILES is CCO[Si](CC[Si](C)(C)O[Si](C)(C)CC[Si](OCC)(OCC)OCC)(OCC)OCC.

How many hydrogen bond donor counts are there in 1,3-Bis(triethoxysilylethyl)tetramethyldisiloxane?

There are no hydrogen bond donor counts.

How many hydrogen bond acceptor counts are there in 1,3-Bis(triethoxysilylethyl)tetramethyldisiloxane?

There are 7 hydrogen bond acceptor counts.

What is the exact mass of 1,3-Bis(triethoxysilylethyl)tetramethyldisiloxane?

The exact mass is 514.26336007 g/mol.

Is 1,3-Bis(triethoxysilylethyl)tetramethyldisiloxane a canonicalized compound?

Yes, it is a canonicalized compound.