1-(2-Methoxyphenyl)piperazine hydrobromide

• CAS: 100939-96-6
• Catalog Number: ACM100939966
• Category: Bromine Series
• Molecular Weight: 273.17
• Molecular Formula: C₁₁H₁₆N₂O.HBr

Custom Q&A

What is the molecular formula of 1-(2-Methoxyphenyl)piperazine hydrobromide?

The molecular formula is C11H17BrN2O.

What is the molecular weight of 1-(2-Methoxyphenyl)piperazine hydrobromide?

The molecular weight is 273.17 g/mol.

What is the IUPAC name of 1-(2-Methoxyphenyl)piperazine hydrobromide?

The IUPAC name is 1-(2-methoxyphenyl)piperazine;hydrobromide.

What is the InChI of 1-(2-Methoxyphenyl)piperazine hydrobromide?

The InChI is InChI=1S/C11H16N2O.BrH/c1-14-11-5-3-2-4-10(11)13-8-6-12-7-9-13;/h2-5,12H,6-9H2,1H3;1H.

What is the InChIKey of 1-(2-Methoxyphenyl)piperazine hydrobromide?

The InChIKey is QPAHBXFXDDEKNB-UHFFFAOYSA-N.

What is the canonical SMILES of 1-(2-Methoxyphenyl)piperazine hydrobromide?

The canonical SMILES is COC1=CC=CC=C1N2CCNCC2.Br.

What is the CAS number of 1-(2-Methoxyphenyl)piperazine hydrobromide?

The CAS number is 100939-96-6.

What is the UNII of 1-(2-Methoxyphenyl)piperazine hydrobromide?

The UNII is 2N1ZY78316.

What is the Hydrogen Bond Donor Count of 1-(2-Methoxyphenyl)piperazine hydrobromide?

The Hydrogen Bond Donor Count is 2.

What is the Monoisotopic Mass of 1-(2-Methoxyphenyl)piperazine hydrobromide?

The Monoisotopic Mass is 272.05243 g/mol.