CAS
--- Purity
---
--- Purity
---
Inquiry Basket
p-Tolyl-acetyl chloride
Catalog Number
ACMA00000512
Category
Alcohols
Molecular Weight
168.62
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
Specification
Hazard Statements
H226-H315-H319-H335
RIDADR
NONH for all modes of transport
Symbol
GHS02
What is the molecular formula of p-Tolyl-acetyl chloride?
The molecular formula of p-Tolyl-acetyl chloride is C9H9ClO.
What are some synonyms for p-Tolyl-acetyl chloride?
Some synonyms for p-Tolyl-acetyl chloride are 2-(4-methylphenyl)acetyl chloride, p-tolylacetyl chloride, P-Tolyl-Acetyl Chloride, and p-Tolyl-acetylchloride.
What is the molecular weight of p-Tolyl-acetyl chloride?
The molecular weight of p-Tolyl-acetyl chloride is 168.62 g/mol.
What is the IUPAC name of p-Tolyl-acetyl chloride?
The IUPAC name of p-Tolyl-acetyl chloride is 2-(4-methylphenyl)acetyl chloride.
What is the InChI of p-Tolyl-acetyl chloride?
The InChI of p-Tolyl-acetyl chloride is InChI=1S/C9H9ClO/c1-7-2-4-8(5-3-7)6-9(10)11/h2-5H,6H2,1H3.
What is the InChIKey of p-Tolyl-acetyl chloride?
The InChIKey of p-Tolyl-acetyl chloride is QDZAWVLWIMOXJT-UHFFFAOYSA-N.
What is the canonical SMILES of p-Tolyl-acetyl chloride?
The canonical SMILES of p-Tolyl-acetyl chloride is CC1=CC=C(C=C1)CC(=O)Cl.
What is the CAS number of p-Tolyl-acetyl chloride?
The CAS number of p-Tolyl-acetyl chloride is 35675-44-6.
What is the European Community (EC) number of p-Tolyl-acetyl chloride?
The European Community (EC) number of p-Tolyl-acetyl chloride is 673-227-1.
What is the topological polar surface area of p-Tolyl-acetyl chloride?
The topological polar surface area of p-Tolyl-acetyl chloride is 17.1Ų.
Recommended Products
![[(2,5-Dihydroxybenzoyl)amino]acetic acid](/v2/images/structure-default.jpg)
