Naphtalene-1,3,6-trisulfonic acid

• CAS: 86-66-8
• Catalog Number: ACM86668
• Category: Other Products
• Molecular Weight: 368.36012
• Molecular Formula: C₁₀H₈O₉S₃
• Synonyms: naphthalene-1,3,6-trisulphonic acid;2,5,7-Naphthalenetrisulfonic acid

Custom Q&A

What is the molecular formula of Naphtalene-1,3,6-trisulfonic acid?

The molecular formula of Naphtalene-1,3,6-trisulfonic acid is C10H8O9S3.

What is the molecular weight of Naphtalene-1,3,6-trisulfonic acid?

The molecular weight of Naphtalene-1,3,6-trisulfonic acid is 368.4 g/mol.

What are some synonyms for Naphtalene-1,3,6-trisulfonic acid?

Some synonyms for Naphtalene-1,3,6-trisulfonic acid are naphthalene-1,3,6-trisulfonic acid, 1,3,6-Naphthalenetrisulfonic acid, and Naphthalene-1,3,6-trisulphonic acid.

What is the InChI key for Naphtalene-1,3,6-trisulfonic acid?

The InChI key for Naphtalene-1,3,6-trisulfonic acid is ZPBSAMLXSQCSOX-UHFFFAOYSA-N.

What is the canonical SMILES notation for Naphtalene-1,3,6-trisulfonic acid?

The canonical SMILES notation for Naphtalene-1,3,6-trisulfonic acid is C1=CC2=C(C=C(C=C2C=C1S(=O)(=O)O)S(=O)(=O)O)S(=O)(=O)O.

What is the CAS number for Naphtalene-1,3,6-trisulfonic acid?

The CAS number for Naphtalene-1,3,6-trisulfonic acid is 86-66-8.

What is the hydrogen bond donor count of Naphtalene-1,3,6-trisulfonic acid?

The hydrogen bond donor count of Naphtalene-1,3,6-trisulfonic acid is 3.

What is the hydrogen bond acceptor count of Naphtalene-1,3,6-trisulfonic acid?

The hydrogen bond acceptor count of Naphtalene-1,3,6-trisulfonic acid is 9.

What is the topological polar surface area of Naphtalene-1,3,6-trisulfonic acid?

The topological polar surface area of Naphtalene-1,3,6-trisulfonic acid is 188 Å2.

How many rotatable bond counts does Naphtalene-1,3,6-trisulfonic acid have?

Naphtalene-1,3,6-trisulfonic acid has 3 rotatable bond counts.