N,N-Diethyl-cyclohexane-1,4-diamine dihydrochloride

• Catalog Number: ACMA00000769
• Category: Amines
• Molecular Weight: 243.22
• Molecular Formula: C₁₀H₂₂N₂
• Hazard Statements: H302
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of N,N-Diethyl-cyclohexane-1,4-diamine dihydrochloride?

The molecular formula is C10H24Cl2N2.

What is the molecular weight of N,N-Diethyl-cyclohexane-1,4-diamine dihydrochloride?

The molecular weight is 243.21 g/mol.

What are some synonyms for N,N-Diethyl-cyclohexane-1,4-diamine dihydrochloride?

Some synonyms include trans-N,N-Diethyl-cyclohexane-1,4-diamine dihydrochloride, N,N-DIETHYL-CYCLOHEXANE-1,4-DIAMINE DIHYDROCHLORIDE, and N1,N1-diethylcyclohexane-1,4-diamine dihydrochloride.

What is the IUPAC name of N,N-Diethyl-cyclohexane-1,4-diamine dihydrochloride?

The IUPAC name is 4-N,4-N-diethylcyclohexane-1,4-diamine;dihydrochloride.

What is the InChI code of N,N-Diethyl-cyclohexane-1,4-diamine dihydrochloride?

The InChI code is InChI=1S/C10H22N2.2ClH/c1-3-12(4-2)10-7-5-9(11)6-8-10;;/h9-10H,3-8,11H2,1-2H3;2*1H.

What is the Canonical SMILES of N,N-Diethyl-cyclohexane-1,4-diamine dihydrochloride?

The Canonical SMILES is CCN(CC)C1CCC(CC1)N.Cl.Cl.

What is the hydrogen bond donor count of N,N-Diethyl-cyclohexane-1,4-diamine dihydrochloride?

The hydrogen bond donor count is 3.

What is the hydrogen bond acceptor count of N,N-Diethyl-cyclohexane-1,4-diamine dihydrochloride?

The hydrogen bond acceptor count is 2.

How many rotatable bonds does N,N-Diethyl-cyclohexane-1,4-diamine dihydrochloride have?

It has 3 rotatable bonds.

Is N,N-Diethyl-cyclohexane-1,4-diamine dihydrochloride categorized as a canonicalized compound?

Yes, it is categorized as a canonicalized compound.