N-Methyl-1-(4-methyl-1,3-thiazol-2-yl)methanamine dihydrochloride

• Catalog Number: ACMA00001367
• Category: Amines
• Molecular Weight: 215.14
• Molecular Formula: C₆H₁₁NO₃
• Hazard Statements: H319
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of N-Methyl-1-(4-methyl-1,3-thiazol-2-yl)methanamine dihydrochloride?

The molecular formula is C6H12Cl2N2S.

What is the molecular weight of N-Methyl-1-(4-methyl-1,3-thiazol-2-yl)methanamine dihydrochloride?

The molecular weight is 215.14 g/mol.

What is the IUPAC name of N-Methyl-1-(4-methyl-1,3-thiazol-2-yl)methanamine dihydrochloride?

The IUPAC name is N-methyl-1-(4-methyl-1,3-thiazol-2-yl)methanamine;dihydrochloride.

What is the InChI of N-Methyl-1-(4-methyl-1,3-thiazol-2-yl)methanamine dihydrochloride?

The InChI is InChI=1S/C6H10N2S.2ClH/c1-5-4-9-6(8-5)3-7-2;;/h4,7H,3H2,1-2H3;2*1H.

What is the InChIKey of N-Methyl-1-(4-methyl-1,3-thiazol-2-yl)methanamine dihydrochloride?

The InChIKey is HUPIALUKIPJUPK-UHFFFAOYSA-N.

What is the canonical SMILES of N-Methyl-1-(4-methyl-1,3-thiazol-2-yl)methanamine dihydrochloride?

The canonical SMILES is CC1=CSC(=N1)CNC.Cl.Cl.

What is the hydrogen bond donor count of N-Methyl-1-(4-methyl-1,3-thiazol-2-yl)methanamine dihydrochloride?

The hydrogen bond donor count is 3.

What is the hydrogen bond acceptor count of N-Methyl-1-(4-methyl-1,3-thiazol-2-yl)methanamine dihydrochloride?

The hydrogen bond acceptor count is 3.

What is the rotatable bond count of N-Methyl-1-(4-methyl-1,3-thiazol-2-yl)methanamine dihydrochloride?

The rotatable bond count is 2.

Is N-Methyl-1-(4-methyl-1,3-thiazol-2-yl)methanamine dihydrochloride a canonicalized compound?

Yes, it is a canonicalized compound.