What is the molecular formula of N-Alfa-fmoc-4-(phosphonodifluoromethyl)-L-phenylalanine?
The molecular formula is C25H22F2NO7P.
When was N-Alfa-fmoc-4-(phosphonodifluoromethyl)-L-phenylalanine created according to the reference?
It was created on October 26, 2006.
What is the molecular weight of N-Alfa-fmoc-4-(phosphonodifluoromethyl)-L-phenylalanine?
The molecular weight is 517.4 g/mol.
What is the IUPAC Name of N-Alfa-fmoc-4-(phosphonodifluoromethyl)-L-phenylalanine?
The IUPAC name is (2S)-3-[4-[difluoro(phosphono)methyl]phenyl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid.
What is the Canonical SMILES of N-Alfa-fmoc-4-(phosphonodifluoromethyl)-L-phenylalanine?
The Canonical SMILES is C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC(CC4=CC=C(C=C4)C(F)(F)P(=O)(O)O)C(=O)O.
How many hydrogen bond donor counts does N-Alfa-fmoc-4-(phosphonodifluoromethyl)-L-phenylalanine have?
It has 4 hydrogen bond donor counts.
What is the XLogP3-AA value of N-Alfa-fmoc-4-(phosphonodifluoromethyl)-L-phenylalanine?
The XLogP3-AA value is 3.4.
What is the topological polar surface area of N-Alfa-fmoc-4-(phosphonodifluoromethyl)-L-phenylalanine?
The topological polar surface area is 133 Ų.
How many rotatable bond counts does N-Alfa-fmoc-4-(phosphonodifluoromethyl)-L-phenylalanine have?
It has 9 rotatable bond counts.
Is N-Alfa-fmoc-4-(phosphonodifluoromethyl)-L-phenylalanine a canonicalized compound according to the reference?
Yes, it is a canonicalized compound.