N-(4-Methoxybenzylidene)-4-fluoroaniline

• CAS: 3381-48-4
• Catalog Number: ACM3381484
• Category: Aryl Fluorinated Building Blocks
• Molecular Weight: 229.25
• Molecular Formula: C₁₄H₉FO₃
• Hazard Statements: H302
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of N-(4-Methoxybenzylidene)-4-fluoroaniline?

The molecular formula is C14H12FNO.

What is the molecular weight of N-(4-Methoxybenzylidene)-4-fluoroaniline?

The molecular weight is 229.25 g/mol.

What is the IUPAC name of N-(4-Methoxybenzylidene)-4-fluoroaniline?

The IUPAC name is N-(4-fluorophenyl)-1-(4-methoxyphenyl)methanimine.

What is the InChI of N-(4-Methoxybenzylidene)-4-fluoroaniline?

The InChI is InChI=1S/C14H12FNO/c1-17-14-8-2-11(3-9-14)10-16-13-6-4-12(15)5-7-13/h2-10H,1H3.

What is the InChIKey of N-(4-Methoxybenzylidene)-4-fluoroaniline?

The InChIKey is ZICFPEHQRZAFBZ-UHFFFAOYSA-N.

What is the canonical SMILES of N-(4-Methoxybenzylidene)-4-fluoroaniline?

The canonical SMILES is COC1=CC=C(C=C1)C=NC2=CC=C(C=C2)F.

What is the CAS number of N-(4-Methoxybenzylidene)-4-fluoroaniline?

The CAS number is 3381-48-4.

What is the EC number of N-(4-Methoxybenzylidene)-4-fluoroaniline?

The EC number is 622-761-3.

What is the hydrogen bond donor count of N-(4-Methoxybenzylidene)-4-fluoroaniline?

The hydrogen bond donor count is 0.

What is the hydrogen bond acceptor count of N-(4-Methoxybenzylidene)-4-fluoroaniline?

The hydrogen bond acceptor count is 3.