Mucobromic acid

• CAS: 488-11-9
• Catalog Number: ACM488119
• Category: Bromine Series
• Molecular Weight: 257.86
• Molecular Formula: C₄H₂O₃Br₂

Custom Q&A

What is the molecular formula of mucobromic acid?

The molecular formula of mucobromic acid is C4H2Br2O3.

What is the molecular weight of mucobromic acid?

The molecular weight of mucobromic acid is 257.86 g/mol.

What is the IUPAC name of mucobromic acid?

The IUPAC name of mucobromic acid is (Z)-2,3-dibromo-4-oxobut-2-enoic acid.

What is the InChI of mucobromic acid?

The InChI of mucobromic acid is InChI=1S/C4H2Br2O3/c5-2(1-7)3(6)4(8)9/h1H,(H,8,9)/b3-2-.

What is the Canonical SMILES of mucobromic acid?

The Canonical SMILES of mucobromic acid is C(=O)C(=C(C(=O)O)Br)Br.

What is the CAS number of mucobromic acid?

The CAS number of mucobromic acid is 488-11-9.

What is the European Community (EC) Number of mucobromic acid?

The European Community (EC) Number of mucobromic acid is 207-670-5.

What is the XLogP3-AA value of mucobromic acid?

The XLogP3-AA value of mucobromic acid is 1.3.

How many hydrogen bond donor counts does mucobromic acid have?

Mucobromic acid has 1 hydrogen bond donor count.

How many rotatable bond counts does mucobromic acid have?

Mucobromic acid has 2 rotatable bond counts.