METHYL VIOLET

• CAS: 603-47-4
• Catalog Number: ACM603474
• Category: Basic Dyes
• Molecular Weight: 393.95
• Molecular Formula: C₂₄H₂₇N₃Cl
• Synonyms: benzenamine,4-[[4-(dimethylamino)phenyl][4-(methylimino)-2,5-cyclohexadien-1-y;benzenamine,n,n-dimethyl-4-((4-(dimethylamino)phenyl)(4-(methylimino)-2,5-cycl;methylviolet2bn200;n,n-dimethyl-4-((4-(dimethylamino)phenyl)(4-(methylimino)-2,5-cyclohexadien-1
• Appearance: Solid

Custom Q&A

What is the molecular formula of methyl violet?

The molecular formula of methyl violet is C24H28ClN3.

What are some synonyms for methyl violet?

Some synonyms for methyl violet are Gentian Violet, Methyl violet 603-47-4, and Pentamethyl pararosaniline chloride.

What is the molecular weight of methyl violet?

The molecular weight of methyl violet is 393.9 g/mol.

What are the medical properties of methyl violet?

Methyl violet is a dye that has antibacterial, antifungal, and anthelmintic properties.

What is the IUPAC Name of methyl violet?

The IUPAC Name of methyl violet is 4-[[4-(dimethylamino)phenyl]-(4-methyliminocyclohexa-2,5-dien-1-ylidene)methyl]-N,N-dimethylaniline hydrochloride.

What is the Canonical SMILES of methyl violet?

The Canonical SMILES of methyl violet is CN=C1C=CC(=C(C2=CC=C(C=C2)N(C)C)C3=CC=C(C=C3)N(C)C)C=C1.Cl.

What is the InChIKey of methyl violet?

The InChIKey of methyl violet is JFTBTTPUYRGXDG-UHFFFAOYSA-N.

How many hydrogen bond donor counts does methyl violet have?

Methyl violet has 1 hydrogen bond donor count.

What is the exact mass of methyl violet?

The exact mass of methyl violet is 393.1971756 g/mol.

What is the topological polar surface area of methyl violet?

The topological polar surface area of methyl violet is 18.8 Å2.