87885-43-6 Purity
95%
If you have any other questions or need other size, please get a quote.
Specification
The IUPAC name of the compound is methyl 3,5-diamino-6-chloropyrazine-2-carboxylate.
The molecular formula of the compound is C6H7ClN4O2.
The molecular weight of the compound is 202.60 g/mol.
The InChI of the compound is InChI=1S/C6H7ClN4O2/c1-13-6(12)2-4(8)11-5(9)3(7)10-2/h1H3,(H4,8,9,11).
The InChIKey of the compound is KOOBYHRLTYIPTH-UHFFFAOYSA-N.
The canonical SMILES of the compound is COC(=O)C1=C(N=C(C(=N1)Cl)N)N.
The CAS number of the compound is 1458-01-1.
There are 2 hydrogen bond donor atoms in the compound.
There are 6 hydrogen bond acceptor atoms in the compound.
There are 2 rotatable bonds in the compound.