What is the molecular formula of Methyl 2-[4-[2-piperidinoethoxy]benzoyl]benzoate hydrochloride?
The molecular formula is C22H26ClNO4.
What is the molecular weight of Methyl 2-[4-[2-piperidinoethoxy]benzoyl]benzoate hydrochloride?
The molecular weight is 403.9 g/mol.
What are the synonyms for Methyl 2-[4-[2-piperidinoethoxy]benzoyl]benzoate hydrochloride?
Some synonyms include Pitofenone hydrochloride, PITOFENONE HCL, and Pitophenone hydrochloride.
What is the IUPAC name of Methyl 2-[4-[2-piperidinoethoxy]benzoyl]benzoate hydrochloride?
The IUPAC name is methyl 2-[4-(2-piperidin-1-ylethoxy)benzoyl]benzoate;hydrochloride.
What is the InChIKey of Methyl 2-[4-[2-piperidinoethoxy]benzoyl]benzoate hydrochloride?
The InChIKey is ZRFIFDFEDPJBII-UHFFFAOYSA-N.
What is the Canonical SMILES representation of Methyl 2-[4-[2-piperidinoethoxy]benzoyl]benzoate hydrochloride?
The Canonical SMILES representation is COC(=O)C1=CC=CC=C1C(=O)C2=CC=C(C=C2)OCCN3CCCCC3.Cl.
What is the CAS number for Methyl 2-[4-[2-piperidinoethoxy]benzoyl]benzoate hydrochloride?
The CAS number is 1248-42-6.
How many hydrogen bond acceptors are present in Methyl 2-[4-[2-piperidinoethoxy]benzoyl]benzoate hydrochloride?
There are 5 hydrogen bond acceptors.
What is the topological polar surface area of Methyl 2-[4-[2-piperidinoethoxy]benzoyl]benzoate hydrochloride?
The topological polar surface area is 55.8 Ų.
Is Methyl 2-[4-[2-piperidinoethoxy]benzoyl]benzoate hydrochloride a canonicalized compound?
Yes, it is a canonicalized compound.