Lignosulfonic Acid, Calcium Salt

• CAS: 8061-52-7
• Catalog Number: ACM8061527
• Category: Anionic Surfactants
• Molecular Weight: 528.61
• Molecular Formula: C₂₀H₂₄CaO₁₀S₂
• Synonyms: LIGNOSULFONIC ACID, CA;LIGNOSULFONIC ACID, CALCIUM SALT;CALCIUM LIGNOSULFONATE;calciumligninsulphonate;ligninsulfonicacid,calcium;ligninsulfonicacid,calciumsalt;Calcium lignosulphonate;Ligninesulfonicacidcalciumsalt

Custom Q&A

What is the molecular formula of Lignosulfonic Acid, Calcium Salt?

The molecular formula is C20H24CaO10S2.

What is the molecular weight of Lignosulfonic Acid, Calcium Salt?

The molecular weight is 528.6 g/mol.

What are some synonyms for Lignosulfonic Acid, Calcium Salt?

Some synonyms include CALCIUM LIGNOSULFONATE and Caswell No. 146.

What is the IUPAC name of Lignosulfonic Acid, Calcium Salt?

The IUPAC name is calcium;3-(2-hydroxy-3-methoxyphenyl)-2-[2-methoxy-4-(3-sulfonatopropyl)phenoxy]propane-1-sulfonate.

What is the InChIKey of Lignosulfonic Acid, Calcium Salt?

The InChIKey is RYAGRZNBULDMBW-UHFFFAOYSA-L.

What is the Canonical SMILES of Lignosulfonic Acid, Calcium Salt?

The Canonical SMILES is COC1=CC=CC(=C1O)CC(CS(=O)(=O)[O-])OC2=C(C=C(C=C2)CCCS(=O)(=O)[O-])OC.[Ca+2].

How many hydrogen bond acceptors are in Lignosulfonic Acid, Calcium Salt?

There are 10 hydrogen bond acceptors.

What is the topological polar surface area of Lignosulfonic Acid, Calcium Salt?

The topological polar surface area is 179 Å^2.

How many rotatable bond counts does Lignosulfonic Acid, Calcium Salt have?

There are 10 rotatable bond counts.

What is the Covalently-Bonded Unit Count of Lignosulfonic Acid, Calcium Salt?

The Covalently-Bonded Unit Count is 2.