What is the molecular formula of Imidazo[2,1-b]thiazole-6-carboxylic acid hydrobromide?
The molecular formula is C6H5BrN2O2S.
What is the molecular weight of Imidazo[2,1-b]thiazole-6-carboxylic acid hydrobromide?
The molecular weight is 249.09 g/mol.
What is the IUPAC name of Imidazo[2,1-b]thiazole-6-carboxylic acid hydrobromide?
The IUPAC name is imidazo[2,1-b][1,3]thiazole-6-carboxylic acid;hydrobromide.
What is the InChI of Imidazo[2,1-b]thiazole-6-carboxylic acid hydrobromide?
The InChI is InChI=1S/C6H4N2O2S.BrH/c9-5(10)4-3-8-1-2-11-6(8)7-4;/h1-3H,(H,9,10);1H.
What is the InChIKey of Imidazo[2,1-b]thiazole-6-carboxylic acid hydrobromide?
The InChIKey is RAVYQOPXHWEAFU-UHFFFAOYSA-N.
What is the canonical SMILES of Imidazo[2,1-b]thiazole-6-carboxylic acid hydrobromide?
The canonical SMILES is C1=CSC2=NC(=CN21)C(=O)O.Br.
What is the CAS number of Imidazo[2,1-b]thiazole-6-carboxylic acid hydrobromide?
The CAS number is 725234-39-9.
What is the hydrogen bond donor count of Imidazo[2,1-b]thiazole-6-carboxylic acid hydrobromide?
The hydrogen bond donor count is 2.
What is the hydrogen bond acceptor count of Imidazo[2,1-b]thiazole-6-carboxylic acid hydrobromide?
The hydrogen bond acceptor count is 4.
Is Imidazo[2,1-b]thiazole-6-carboxylic acid hydrobromide a canonicalized compound?
Yes, Imidazo[2,1-b]thiazole-6-carboxylic acid hydrobromide is a canonicalized compound.