(Imidazo[2,1-b][1,3]thiazol-6-ylmethyl)amine dihydrochloride

• Catalog Number: ACMA00001393
• Category: Amines
• Molecular Weight: 226.13
• Molecular Formula: C₆H₇Cl₂N
• Hazard Statements: H317-H319
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of (Imidazo[2,1-b][1,3]thiazol-6-ylmethyl)amine dihydrochloride?

The molecular formula is C6H9Cl2N3S.

What is the PubChem CID of (Imidazo[2,1-b][1,3]thiazol-6-ylmethyl)amine dihydrochloride?

The PubChem CID is 43810536.

What is the molecular weight of (Imidazo[2,1-b][1,3]thiazol-6-ylmethyl)amine dihydrochloride?

The molecular weight is 226.13 g/mol.

What is the IUPAC Name of (Imidazo[2,1-b][1,3]thiazol-6-ylmethyl)amine dihydrochloride?

The IUPAC Name is imidazo[2,1-b][1,3]thiazol-6-ylmethanamine;dihydrochloride.

What is the InChI of (Imidazo[2,1-b][1,3]thiazol-6-ylmethyl)amine dihydrochloride?

The InChI is InChI=1S/C6H7N3S.2ClH/c7-3-5-4-9-1-2-10-6(9)8-5;;/h1-2,4H,3,7H2;2*1H.

What is the InChIKey of (Imidazo[2,1-b][1,3]thiazol-6-ylmethyl)amine dihydrochloride?

The InChIKey is GGDPTFFNPHDTFD-UHFFFAOYSA-N.

What is the Canonical SMILES of (Imidazo[2,1-b][1,3]thiazol-6-ylmethyl)amine dihydrochloride?

The Canonical SMILES is C1=CSC2=NC(=CN21)CN.Cl.Cl.

How many hydrogen bond donor counts does (Imidazo[2,1-b][1,3]thiazol-6-ylmethyl)amine dihydrochloride have?

It has 3 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does (Imidazo[2,1-b][1,3]thiazol-6-ylmethyl)amine dihydrochloride have?

It has 3 hydrogen bond acceptor counts.

What is the topological polar surface area of (Imidazo[2,1-b][1,3]thiazol-6-ylmethyl)amine dihydrochloride?

The topological polar surface area is 71.6Ų.