H-D-Pro-phe-arg-chloromethylketone

• CAS: 88546-74-1
• Catalog Number: ACM88546741
• Category: Other Products
• Molecular Weight: 450.96
• Molecular Formula: C₂₁H₃₁ClN₆O₃
• Synonyms: H-D-PRO-PHE-ARG-CHLOROMETHYLKETONE;DPRO-PHE-ARG-CHLOROMETHYLKETONE;DPRO-PHE-ARG-CMK

Custom Q&A

What is the molecular formula of H-D-Pro-Phe-Arg-chloromethylketone?

The molecular formula is C21H31ClN6O3.

When was H-D-Pro-Phe-Arg-chloromethylketone first created in the database?

It was first created on October 25, 2006.

What is the molecular weight of H-D-Pro-Phe-Arg-chloromethylketone?

The molecular weight is 451.0 g/mol.

What is the IUPAC name of H-D-Pro-Phe-Arg-chloromethylketone?

The IUPAC name is (2R)-N-[(2S)-1-[[(3S)-1-chloro-6-(diaminomethylideneamino)-2-oxohexan-3-yl]amino]-1-oxo-3-phenylpropan-2-yl]pyrrolidine-2-carboxamide.

What is the InChIKey of H-D-Pro-Phe-Arg-chloromethylketone?

The InChIKey is HCCRRLVJBLDSLL-BBWFWOEESA-N.

What is the Canonical SMILES of H-D-Pro-Phe-Arg-chloromethylketone?

The Canonical SMILES is C1CC(NC1)C(=O)NC(CC2=CC=CC=C2)C(=O)NC(CCCN=C(N)N)C(=O)CCl.

What is the XLogP3 value of H-D-Pro-Phe-Arg-chloromethylketone?

The XLogP3 value is -0.5.

How many hydrogen bond donor counts are there in H-D-Pro-Phe-Arg-chloromethylketone?

There are 5 hydrogen bond donor counts.

What is the topological polar surface area of H-D-Pro-Phe-Arg-chloromethylketone?

The topological polar surface area is 152 Ų.

How many defined atom stereocenter counts are there in H-D-Pro-Phe-Arg-chloromethylketone?

There are 3 defined atom stereocenter counts.