Gemifioxacin mesylate

CAS

210353-53-0

Catalog Number

ACM210353530

Category

Other Products

Molecular Weight

485.49

Molecular Formula

C₁₉H₂₄FN₅O₇S

MSDS COA Spec Sheet

If you have any other questions or need other size, please get a quote.

Specification

Synonyms

GEMIFIOXACIN MESYLATE;7-(3-aminomethyl)-4-methoxyimino-pyrrolidin-1-yl)-1-cyclopropyl-6-fluoro-4-oxo-1,4-dihydro-[1,8]naphthyridine-3-carboxylic acid mesylate;7-(3-Aminomethyl)-4-methoxyimino-pyrrolidin-1-yl)-1-cyclopropyl-6-fluoro-4-oxo-1,4-dihydro-[1,8]naphthyridine-3-carboxylic acid mesylate;LB-20304 Mesilate

Melting Point

235-2370C

What is the molecular formula of Gemifioxacin mesylate?

The molecular formula of Gemifioxacin mesylate is C19H24FN5O7S.

What is the molecular weight of Gemifioxacin mesylate?

The molecular weight of Gemifioxacin mesylate is 485.5 g/mol.

What is the IUPAC name of Gemifioxacin mesylate?

The IUPAC name of Gemifioxacin mesylate is 7-[(4E)-3-(aminomethyl)-4-methoxyiminopyrrolidin-1-yl]-1-cyclopropyl-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylic acid;methanesulfonic acid.

What is the InChI of Gemifioxacin mesylate?

The InChI of Gemifioxacin mesylate is InChI=1S/C18H20FN5O4.CH4O3S/c1-28-22-14-8-23(6-9(14)5-20)17-13(19)4-11-15(25)12(18(26)27)7-24(10-2-3-10)16(11)21-17;1-5(2,3)4/h4,7,9-10H,2-3,5-6,8,20H2,1H3,(H,26,27);1H3,(H,2,3,4)/b22-14-.

What is the InChIKey of Gemifioxacin mesylate?

The InChIKey of Gemifioxacin mesylate is JIYMVSQRGZEYAX-YDHFHHHVSA-N.

What is the canonical SMILES of Gemifioxacin mesylate?

The canonical SMILES of Gemifioxacin mesylate is CON=C1CN(CC1CN)C2=C(C=C3C(=O)C(=CN(C3=N2)C4CC4)C(=O)O)F.CS(=O)(=O)O.

What is the isomeric SMILES of Gemifioxacin mesylate?

The isomeric SMILES of Gemifioxacin mesylate is CO/N=C\1/CN(CC1CN)C2=C(C=C3C(=O)C(=CN(C3=N2)C4CC4)C(=O)O)F.CS(=O)(=O)O.

How many hydrogen bond donor counts does Gemifioxacin mesylate have?

Gemifioxacin mesylate has 3 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does Gemifioxacin mesylate have?

Gemifioxacin mesylate has 13 hydrogen bond acceptor counts.

How many rotatable bond counts does Gemifioxacin mesylate have?

Gemifioxacin mesylate has 5 rotatable bond counts.